![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 3 disc cooling tower.JPG | 2025-08-15 13:25 | 152K | |
| Cooling Tower Data plate.JPG | 2025-08-15 13:25 | 612K | |
| Cooling Tower Decal.JPG | 2025-08-15 13:25 | 563K | |
| Cooling Tower and Penthouse.JPG | 2025-08-15 13:25 | 602K | |
| Cooling Tower pump 2.JPG | 2025-08-15 13:25 | 672K | |
| Cooling Towers.JPG | 2025-08-15 13:25 | 617K | |
| Cooling Towers W Pipe.JPG | 2025-08-15 13:25 | 618K | |
| Thumbs.db | 2025-08-15 13:25 | 78K | |
| chemical injection.JPG | 2025-08-15 13:25 | 135K | |
| chemical injection pump.JPG | 2025-08-15 13:25 | 148K | |
| cooling tower fan motor.JPG | 2025-08-15 13:25 | 148K | |
| cooling tower ifo plate.JPG | 2025-08-15 13:25 | 150K | |
| cooling tower on the roof.JPG | 2025-08-15 13:25 | 151K | |
| cooling tower pipe.JPG | 2025-08-15 13:25 | 143K | |
| cooling tower pipe and pump.JPG | 2025-08-15 13:25 | 148K | |
| cooling tower pipe overhead.JPG | 2025-08-15 13:25 | 152K | |
| cooling tower pump.JPG | 2025-08-15 13:25 | 151K | |
| cooling tower pump ifo.JPG | 2025-08-15 13:25 | 138K | |
| cooling tower pump mtr ifo plate.JPG | 2025-08-15 13:25 | 156K | |
