![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Construction Equipment Dangers.docx | 2025-08-15 14:45 | 13K | |
| Drug Policy.docx | 2025-08-15 14:45 | 12K | |
| ELECTRICAL SAFTEY MANUAL.doc | 2025-08-15 14:45 | 370K | |
| LOCKOUT PROCEDURES.docx | 2025-08-15 14:45 | 13K | |
| Ladder Safet1.docx | 2025-08-15 14:45 | 14K | |
| Ladder Safety.docx | 2025-08-15 14:45 | 14K | |
| Preventing Slips.docx | 2025-08-15 14:45 | 12K | |
| Protecting Your Eyes.docx | 2025-08-15 14:45 | 13K | |
| SAFTEY MEETING SIGN IN SHEET.docx | 2025-08-15 14:45 | 10K | |
| Safety Info Binder 1.pdf | 2025-08-15 14:45 | 515K | |
| Safety Meeting Topics.docx | 2025-08-15 14:45 | 10K | |
| Saving Lives with Lockout.docx | 2025-08-15 14:45 | 14K | |
| Scaffold Safety.docx | 2025-08-15 14:45 | 12K | |
| Sudden Cardiac Arrest and Electrical Safety.docx | 2025-08-15 14:45 | 17K | |
| Using Portable Electric.docx | 2025-08-15 14:45 | 14K | |
| What To Do In Case Of Fire.docx | 2025-08-15 14:45 | 13K | |
| Work Clothes and Safety.docx | 2025-08-15 14:45 | 12K | |
| Working Safely in Confined Spaces.docx | 2025-08-15 14:45 | 15K | |