![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A1.dwg | 2025-08-12 10:35 | 175K | |
| A2.dwg | 2025-08-12 10:35 | 130K | |
| acadstk.dmp | 2025-08-12 10:35 | 4.5K | |
| Basic Wind Speed by Location.pdf | 2025-08-12 10:35 | 145K | |
| Border.bak | 2025-08-12 10:35 | 333K | |
| Border.dwg | 2025-08-12 10:35 | 330K | |
| C-2 Station Section 1 of 2.pdf | 2025-08-12 10:35 | 11K | |
| C-2 Station Section 2 of 2.pdf | 2025-08-12 10:35 | 12K | |
| C-2.bak | 2025-08-12 10:35 | 244K | |
| C-2.dwg | 2025-08-12 10:35 | 262K | |
| C-2.pdf | 2025-08-12 10:35 | 312K | |
| C-3 Blank Plan-Profile.bak | 2025-08-12 10:35 | 137K | |
| C-3 Blank Plan-Profile.dwg | 2025-08-12 10:35 | 145K | |
| C-3 N. Montz Ave Plan-Profile.bak | 2025-08-12 10:35 | 152K | |
| C-3 N. Montz Ave Plan-Profile.dwg | 2025-08-12 10:35 | 152K | |
| C-3 Roadway PLAN AND PROFILE.dwg | 2025-08-12 10:35 | 421K | |
| C3.bak | 2025-08-12 10:35 | 143K | |
| CB-06 INLET DETAIL.dwg | 2025-08-12 10:35 | 621K | |
| CB-06 INLET DETAIL.dwl | 2025-08-12 10:35 | 53 | |
| CB-06 INLET DETAIL.dwl2 | 2025-08-12 10:35 | 203 | |
| combined_profiles_r3.bak | 2025-08-12 10:35 | 794K | |
| combined_profiles_r3.dwg | 2025-08-12 10:35 | 557K | |
| DOTD 2011 Hydraulics Manual.pdf | 2025-08-12 10:35 | 5.3M | |
| Drain-1.dwg | 2025-08-12 10:35 | 962K | |
| Drain-2.dwg | 2025-08-12 10:35 | 673K | |
| drainage calcs.pdf | 2025-08-12 10:35 | 292K | |
| drainage reaches.pdf | 2025-08-12 10:35 | 136K | |
| End Elevation.pdf | 2025-08-12 10:35 | 9.3K | |
| GeoTech Report Insul-Tech Warehouse.pdf | 2025-08-12 10:35 | 12M | |
| MWFRS Wind Load Calculations.docx | 2025-08-12 10:35 | 18K | |
| MWFRS Wind Load Calculations.old.pdf | 2025-08-12 10:35 | 1.6M | |
| MWFRS.xls | 2025-08-12 10:35 | 27K | |
| North Elevation.pdf | 2025-08-12 10:35 | 13K | |
| Pipe Slope.xlsx | 2025-08-12 10:35 | 13K | |
| Plan View Building.pdf | 2025-08-12 10:35 | 33K | |
| plot.log | 2025-08-12 10:35 | 1.6K | |
| Potable Water Profile.bak | 2025-08-12 10:35 | 463K | |
| Potable Water Profile.dwg | 2025-08-12 10:35 | 463K | |
| Rational Method Drainage Calculations.xlsx | 2025-08-12 10:35 | 43K | |
| Rigid Frame Members.pdf | 2025-08-12 10:35 | 9.9K | |
| Rigid Frames 1 & 5.pdf | 2025-08-12 10:35 | 13K | |
| Rigid Frames 2,3,4.pdf | 2025-08-12 10:35 | 8.4K | |
| Road-1.dwg | 2025-08-12 10:35 | 906K | |
| Road-2.dwg | 2025-08-12 10:35 | 571K | |
| Road-3.dwg | 2025-08-12 10:35 | 575K | |
| Roof Plan.pdf | 2025-08-12 10:35 | 9.6K | |
| S-1.bak | 2025-08-12 10:35 | 159K | |
| S-1.dwg | 2025-08-12 10:35 | 259K | |
| Sewer-1.dwg | 2025-08-12 10:35 | 969K | |
| Sewer-2.dwg | 2025-08-12 10:35 | 942K | |
| Slab and Foundation[1].dwg | 2025-08-12 10:35 | 99K | |
| Soil Report.pdf | 2025-08-12 10:35 | 1.0M | |
| South Elevation.pdf | 2025-08-12 10:35 | 16K | |
| Survey.dwg | 2025-08-12 10:35 | 108K | |
| Survey.dwl | 2025-08-12 10:35 | 55 | |
| Title Sheet.bak | 2025-08-12 10:35 | 180K | |
| Title Sheet.dwg | 2025-08-12 10:35 | 194K | |
| Wind Loads on face of Building.pdf | 2025-08-12 10:35 | 17K | |
| C Sheets/ | 2025-08-12 10:35 | - | |
| Cframe/ | 2025-08-12 10:35 | - | |
| earthwork/ | 2025-08-12 10:35 | - | |
| Fire Station/ | 2025-08-12 10:35 | - | |
| Metal Building 1/ | 2025-08-12 10:35 | - | |
| Misc Drawings/ | 2025-08-12 10:35 | - | |
| Plan-Profile Sheets/ | 2025-08-12 10:35 | - | |
| Potable Water/ | 2025-08-12 10:35 | - | |
| Reports Section/ | 2025-08-12 10:35 | - | |
| Roads/ | 2025-08-12 10:35 | - | |
| Runoff/ | 2025-08-12 10:35 | - | |
| sewer/ | 2025-08-12 10:35 | - | |
| Structure/ | 2025-08-12 10:35 | - | |