![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Study of Static and Dynamic Modulus of Elasticity of Concrete-CRC_43.pdf | 2025-08-15 15:06 | 1.4M | |
| REINFORCEMENT FOR CONCRETE - Materials and Applications.pdf | 2025-08-15 15:06 | 7.5M | |
| interaction_diagram_for_concrete_columns.pdf | 2025-08-15 15:06 | 159K | |
| Guidelines for Authorities and Responsibilities in Concrete Design & Construction.pdf | 2025-08-15 15:06 | 102K | |
| CLT_and_AE_Methods_of_In-Situ_Load_Testing-CRC_42.pdf | 2025-08-15 15:06 | 1.9M | |
| CHEMICAL ADMIXTURES FOR CONCRETE.pdf | 2025-08-15 15:06 | 101K | |
| CEMENTITIOUS MATERIALS FOR CONCRETE.pdf | 2025-08-15 15:06 | 2.8M | |
| buried_concrete_basement_wall_desgin.pdf | 2025-08-15 15:06 | 126K | |
| allowable_stress_design_of_RC_masonry_shear_wall.pdf | 2025-08-15 15:06 | 77K | |
| Aggregates for Concrete.pdf | 2025-08-15 15:06 | 665K | |
| acceptance_of_concrete_test_results.pdf | 2025-08-15 15:06 | 31K | |