![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| JP Zoning 1.pdf | 2025-08-15 15:07 | 2.6K | |
| ATC Hazards by Location.pdf | 2025-08-15 15:07 | 45K | |
| JP Zoning.pdf | 2025-08-15 15:07 | 69K | |
| JP Zoning Lot 27A Bldg Structure.pdf | 2025-08-15 15:07 | 75K | |
| JP Zoning Lot 27B Lot.pdf | 2025-08-15 15:07 | 77K | |
| JP Zoning Lot 27A Lot.pdf | 2025-08-15 15:07 | 81K | |
| MWFRS Wind Load Calc.pdf | 2025-08-15 15:07 | 107K | |
| JP Zoning Map.PNG | 2025-08-15 15:07 | 149K | |
| 810 Helios Avenue, Metairie, LA.dwg | 2025-08-15 15:07 | 246K | |
| #810 Helios with Addition_Rev01.dxf | 2025-08-15 15:07 | 361K | |
| Fig 28.6-1.pdf | 2025-08-15 15:07 | 389K | |
| MWFRS Wind Load Calc.xls | 2025-08-15 15:07 | 444K | |
| 810 Helios with Addition_Rev01.pdf | 2025-08-15 15:07 | 1.4M | |
| Roof Lines , pdf.pdf | 2025-08-15 15:07 | 1.4M | |
| 110 mph Exposure C (S6-1).pdf | 2025-08-15 15:07 | 2.0M | |
| R1A - Jefferson Parish, LA Code of Ordinances.pdf | 2025-08-15 15:07 | 2.2M | |